* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX115007 |
English Synonyms: | WUXIAPPTEC WX115007 |
MDL Number.: | MFCD12198735 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(C)(C)OC(=O)N1CC[C@H]2[C@@H](C1)c3cc(ccc3N2)Cl |
InChi: | InChI=1S/C16H21ClN2O2/c1-16(2,3)21-15(20)19-7-6-14-12(9-19)11-8-10(17)4-5-13(11)18-14/h4-5,8,12,14,18H,6-7,9H2,1-3H3/t12-,14-/m0/s1 |
InChiKey: | InChIKey=NUSSODRBWFEQDM-JSGCOSHPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.