* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX115008 |
English Synonyms: | WUXIAPPTEC WX115008 |
MDL Number.: | MFCD12198736 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(C)(C)OC(=O)N1CC[C@H]2[C@@H](C1)c3ccccc3N2 |
InChi: | InChI=1S/C16H22N2O2/c1-16(2,3)20-15(19)18-9-8-14-12(10-18)11-6-4-5-7-13(11)17-14/h4-7,12,14,17H,8-10H2,1-3H3/t12-,14-/m0/s1 |
InChiKey: | InChIKey=ZYHWMEDAZOEDFU-JSGCOSHPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.