* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX115012 |
English Synonyms: | WUXIAPPTEC WX115012 |
MDL Number.: | MFCD12198739 |
H bond acceptor: | 8 |
H bond donor: | 0 |
Smile: | CCOC(=O)[C@]12CN(C[C@]1(CN(C2)C(=O)OC(C)(C)C)c3ccccc3)C(=O)OCc4ccccc4 |
InChi: | InChI=1S/C28H34N2O6/c1-5-34-23(31)28-19-29(24(32)35-16-21-12-8-6-9-13-21)17-27(28,22-14-10-7-11-15-22)18-30(20-28)25(33)36-26(2,3)4/h6-15H,5,16-20H2,1-4H3/t27-,28+/m0/s1 |
InChiKey: | InChIKey=ACZMGHNGLPBWNZ-WUFINQPMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.