* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9H-PYRAZOLO[3,4-C][1,2,4]TRIAZOLO[4,3-A]PYRIDINE-3-CARBOXYLIC ACID |
| English Synonyms: | 9H-PYRAZOLO[3,4-C][1,2,4]TRIAZOLO[4,3-A]PYRIDINE-3-CARBOXYLIC ACID |
| MDL Number.: | MFCD12401452 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | N=1N=C(N2C1C1=C(C=C2)C=NN1)C(=O)O |
| InChi: | InChI=1S/C8H5N5O2/c14-8(15)7-12-11-6-5-4(3-9-10-5)1-2-13(6)7/h1-3H,(H,9,10)(H,14,15) |
| InChiKey: | InChIKey=LZBDIRGODINGBX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.