* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HEXAHYDROTHIENO[3,4-E][1,2,4]TRIAZIN-3(4H)-ONE 6,6-DIOXIDE |
| English Synonyms: | HEXAHYDROTHIENO[3,4-E][1,2,4]TRIAZIN-3(4H)-ONE 6,6-DIOXIDE |
| MDL Number.: | MFCD12401838 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | C1C2C(CS1(=O)=O)NNC(=O)N2 |
| InChi: | InChI=1S/C5H9N3O3S/c9-5-6-3-1-12(10,11)2-4(3)7-8-5/h3-4,7H,1-2H2,(H2,6,8,9) |
| InChiKey: | InChIKey=XREBXJBILFDSOL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.