* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-METHYL-1,9-DIAZA-SPIRO[5.5]UNDECANE |
| CAS: | 1158750-02-7 |
| English Synonyms: | 9-METHYL-1,9-DIAZA-SPIRO[5.5]UNDECANE |
| MDL Number.: | MFCD12406523 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CN1CCC2(CCCCN2)CC1 |
| InChi: | InChI=1S/C10H20N2/c1-12-8-5-10(6-9-12)4-2-3-7-11-10/h11H,2-9H2,1H3 |
| InChiKey: | InChIKey=RTTVWCGHORKNIM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.