* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HONGHUI-MED 170030070000 |
| CAS: | 162209-40-7 |
| English Synonyms: | HONGHUI-MED 170030070000 |
| MDL Number.: | MFCD12407292 |
| H bond acceptor: | 10 |
| H bond donor: | 2 |
| Smile: | c1cc2c3c(c1)Cc4cccc(c4OCCO)Cc5cccc(c5OCCOCCOCCOCCOCCO3)Cc6cccc(c6OCCO)C2 |
| InChi: | InChI=1S/C42H50O10/c43-13-15-49-39-31-5-1-6-32(39)28-36-10-4-12-38-30-34-8-2-7-33(40(34)50-16-14-44)29-37-11-3-9-35(27-31)41(37)51-25-23-47-21-19-45-17-18-46-20-22-48-24-26-52-42(36)38/h1-12,43-44H,13-30H2 |
| InChiKey: | InChIKey=UIWWOQYKPJYANH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.