* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-PHENYLGUANINE |
CAS: | 14443-33-5 |
English Synonyms: | 9-PHENYLGUANINE ; 6H-PURIN-6-ONE, 2-AMINO-1,9-DIHYDRO-9-PHENYL- |
MDL Number.: | MFCD12408078 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)n2cnc3c2nc([nH]c3=O)N |
InChi: | InChI=1S/C11H9N5O/c12-11-14-9-8(10(17)15-11)13-6-16(9)7-4-2-1-3-5-7/h1-6H,(H3,12,14,15,17) |
InChiKey: | InChIKey=XOVSLVYAFGLDMS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.