* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-METHOXY-2H,3H,4H,5H,5AH,6H,7H,11BH-NAPHTHO[1,2-B][1,4]OXAZEPINE |
| English Synonyms: | 9-METHOXY-2H,3H,4H,5H,5AH,6H,7H,11BH-NAPHTHO[1,2-B][1,4]OXAZEPINE |
| MDL Number.: | MFCD12421208 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | COc1ccc2c(c1)CCC3C2OCCCN3 |
| InChi: | InChI=1S/C14H19NO2/c1-16-11-4-5-12-10(9-11)3-6-13-14(12)17-8-2-7-15-13/h4-5,9,13-15H,2-3,6-8H2,1H3 |
| InChiKey: | InChIKey=LTJGHPQGCDIYSG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.