* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-ETHYL-N-(PROPAN-2-YL)-2,3,4,5-TETRAHYDRO-1-BENZOXEPIN-5-AMINE |
| English Synonyms: | 9-ETHYL-N-(PROPAN-2-YL)-2,3,4,5-TETRAHYDRO-1-BENZOXEPIN-5-AMINE |
| MDL Number.: | MFCD12423739 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCc1cccc2c1OCCCC2NC(C)C |
| InChi: | InChI=1S/C15H23NO/c1-4-12-7-5-8-13-14(16-11(2)3)9-6-10-17-15(12)13/h5,7-8,11,14,16H,4,6,9-10H2,1-3H3 |
| InChiKey: | InChIKey=CDSBKTTYYBKIQZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.