* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-([2-(2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)ETHYL]AMINO)-1,3,4-THIADIAZOLE-2-THIOL |
English Synonyms: | 5-([2-(2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)ETHYL]AMINO)-1,3,4-THIADIAZOLE-2-THIOL |
MDL Number.: | MFCD12487176 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cc2c(cc1CCNc3nnc(s3)S)OCCO2 |
InChi: | InChI=1S/C12H13N3O2S2/c18-12-15-14-11(19-12)13-4-3-8-1-2-9-10(7-8)17-6-5-16-9/h1-2,7H,3-6H2,(H,13,14)(H,15,18) |
InChiKey: | InChIKey=UKEBYNPPXYOYEX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.