* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-CHLORO-1-(2-ETHYLPHENYL)-1H-1,3-BENZODIAZOLE-2-THIOL |
| English Synonyms: | 5-CHLORO-1-(2-ETHYLPHENYL)-1H-1,3-BENZODIAZOLE-2-THIOL |
| MDL Number.: | MFCD12498151 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CCc1ccccc1n2c3ccc(cc3nc2S)Cl |
| InChi: | InChI=1S/C15H13ClN2S/c1-2-10-5-3-4-6-13(10)18-14-8-7-11(16)9-12(14)17-15(18)19/h3-9H,2H2,1H3,(H,17,19) |
| InChiKey: | InChIKey=QJMAMVMVOZHMFY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.