* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-[(2-FLUOROPHENYL)SULFONYL]-4H,5H,6H,7H-THIENO[3,2-C]PYRIDINE |
| English Synonyms: | 5-[(2-FLUOROPHENYL)SULFONYL]-4H,5H,6H,7H-THIENO[3,2-C]PYRIDINE |
| MDL Number.: | MFCD12532707 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1ccc(c(c1)F)S(=O)(=O)N2CCc3c(ccs3)C2 |
| InChi: | InChI=1S/C13H12FNO2S2/c14-11-3-1-2-4-13(11)19(16,17)15-7-5-12-10(9-15)6-8-18-12/h1-4,6,8H,5,7,9H2 |
| InChiKey: | InChIKey=NLEVNZGFVQVHRC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.