* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | DEC-1-EN-2-OL |
CAS: | 23358-96-5 |
English Synonyms: | DEC-1-EN-2-OL |
MDL Number.: | MFCD12547136 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCCCCCCCC(=C)O |
InChi: | InChI=1S/C10H20O/c1-3-4-5-6-7-8-9-10(2)11/h11H,2-9H2,1H3 |
InChiKey: | InChIKey=LDSZNKOYKQUZJL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.