* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5,7-DIHYDROXY-2-PHENYLQUINOLIN-4(1H)-ONE |
English Synonyms: | 5,7-DIHYDROXY-2-PHENYLQUINOLIN-4(1H)-ONE |
MDL Number.: | MFCD12547380 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | OC1=C2C(C=C(NC2=CC(=C1)O)C1=CC=CC=C1)=O |
InChi: | InChI=1S/C15H11NO3/c17-10-6-12-15(13(18)7-10)14(19)8-11(16-12)9-4-2-1-3-5-9/h1-8,17-18H,(H,16,19) |
InChiKey: | InChIKey=UKWWGFUNTHQBBZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.