* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | TIMTEC-BB SBB045811 |
| English Synonyms: | TIMTEC-BB SBB045811 |
| MDL Number.: | MFCD12548334 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | Cc1cccc(c1OCC(Cn2c3ccccc3nc2C4CC(=O)N(C4)Cc5ccccc5)O)C |
| InChi: | InChI=1S/C29H31N3O3/c1-20-9-8-10-21(2)28(20)35-19-24(33)18-32-26-14-7-6-13-25(26)30-29(32)23-15-27(34)31(17-23)16-22-11-4-3-5-12-22/h3-14,23-24,33H,15-19H2,1-2H3 |
| InChiKey: | InChIKey=MVRRAHCRJPOACR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.