* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | TIMTEC-BB SBB045846 |
| English Synonyms: | TIMTEC-BB SBB045846 |
| MDL Number.: | MFCD12548364 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cc1ccc2c(c1)nc([nH]2)COc3ccc(cc3OC)CC=C |
| InChi: | InChI=1S/C19H20N2O2/c1-4-5-14-7-9-17(18(11-14)22-3)23-12-19-20-15-8-6-13(2)10-16(15)21-19/h4,6-11H,1,5,12H2,2-3H3,(H,20,21) |
| InChiKey: | InChIKey=YZDORTLKHUWKTD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.