* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | TIMTEC-BB SBB045866 |
| English Synonyms: | TIMTEC-BB SBB045866 |
| MDL Number.: | MFCD12548384 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1cccc2c1nc([nH]2)C(C)Oc3ccc(c(c3)C)C |
| InChi: | InChI=1S/C18H20N2O/c1-11-8-9-15(10-13(11)3)21-14(4)18-19-16-7-5-6-12(2)17(16)20-18/h5-10,14H,1-4H3,(H,19,20) |
| InChiKey: | InChIKey=NEJHSLJSRHKQSB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.