* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-NITRO-N-[1-(THIOPHEN-2-YL)ETHYL]IMIDAZO[2,1-B][1,3]THIAZOL-6-AMINE |
English Synonyms: | 5-NITRO-N-[1-(THIOPHEN-2-YL)ETHYL]IMIDAZO[2,1-B][1,3]THIAZOL-6-AMINE |
MDL Number.: | MFCD12562101 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CC(c1cccs1)Nc2c(n3ccsc3n2)[N+](=O)[O-] |
InChi: | InChI=1S/C11H10N4O2S2/c1-7(8-3-2-5-18-8)12-9-10(15(16)17)14-4-6-19-11(14)13-9/h2-7,12H,1H3 |
InChiKey: | InChIKey=TTYYDYGHKLMHAZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.