* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC934431 |
English Synonyms: | BCH-RESEARCH BC934431 |
MDL Number.: | MFCD12562243 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | c1ccc(c(c1)C(=O)Nc2cccc(c2)C(=O)N)N |
InChi: | InChI=1S/C14H13N3O2/c15-12-7-2-1-6-11(12)14(19)17-10-5-3-4-9(8-10)13(16)18/h1-8H,15H2,(H2,16,18)(H,17,19) |
InChiKey: | InChIKey=RTIPCZKHVAGZBI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.