* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC822420 |
English Synonyms: | BCH-RESEARCH BC822420 |
MDL Number.: | MFCD12563654 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | Cc1c(c(n(n1)C)C)S(=O)(=O)N(C)CC(=O)OC |
InChi: | InChI=1S/C10H17N3O4S/c1-7-10(8(2)13(4)11-7)18(15,16)12(3)6-9(14)17-5/h6H2,1-5H3 |
InChiKey: | InChIKey=HLBNBIZQEUOMEV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.