* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-[(1-CYCLOPENTYL-1H-1,2,3,4-TETRAZOL-5-YL)SULFANYL]PENTAN-2-ONE |
English Synonyms: | 5-[(1-CYCLOPENTYL-1H-1,2,3,4-TETRAZOL-5-YL)SULFANYL]PENTAN-2-ONE |
MDL Number.: | MFCD12566845 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CC(=O)CCCSc1nnnn1C2CCCC2 |
InChi: | InChI=1S/C11H18N4OS/c1-9(16)5-4-8-17-11-12-13-14-15(11)10-6-2-3-7-10/h10H,2-8H2,1H3 |
InChiKey: | InChIKey=NDPIZBGDQOWIAB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.