* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-(3-FLUOROBENZOYL)-2,3-DIHYDRO-1H-1,3-BENZODIAZOL-2-ONE |
English Synonyms: | 5-(3-FLUOROBENZOYL)-2,3-DIHYDRO-1H-1,3-BENZODIAZOL-2-ONE |
MDL Number.: | MFCD12569120 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1cc(cc(c1)F)C(=O)c2ccc3c(c2)[nH]c(=O)[nH]3 |
InChi: | InChI=1S/C14H9FN2O2/c15-10-3-1-2-8(6-10)13(18)9-4-5-11-12(7-9)17-14(19)16-11/h1-7H,(H2,16,17,19) |
InChiKey: | InChIKey=QMYQUCKRNXEDNO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.