* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-(1-AMINO-2,2,3,3,3-PENTAFLUOROPROPYL)-2,3-DIHYDRO-1H-INDOL-2-ONE |
English Synonyms: | 5-(1-AMINO-2,2,3,3,3-PENTAFLUOROPROPYL)-2,3-DIHYDRO-1H-INDOL-2-ONE |
MDL Number.: | MFCD12571184 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1cc2c(cc1C(C(C(F)(F)F)(F)F)N)CC(=O)N2 |
InChi: | InChI=1S/C11H9F5N2O/c12-10(13,11(14,15)16)9(17)5-1-2-7-6(3-5)4-8(19)18-7/h1-3,9H,4,17H2,(H,18,19) |
InChiKey: | InChIKey=BJYZCAIIBSRAMM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.