* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-N-(3,5-DICHLOROPHENYL)-1,3-BENZOTHIAZOLE-4,5-DIAMINE |
| English Synonyms: | 5-N-(3,5-DICHLOROPHENYL)-1,3-BENZOTHIAZOLE-4,5-DIAMINE |
| MDL Number.: | MFCD12578426 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | c1cc2c(c(c1Nc3cc(cc(c3)Cl)Cl)N)ncs2 |
| InChi: | InChI=1S/C13H9Cl2N3S/c14-7-3-8(15)5-9(4-7)18-10-1-2-11-13(12(10)16)17-6-19-11/h1-6,18H,16H2 |
| InChiKey: | InChIKey=UYTXBVDALLMXAY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.