* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-AMINO-2-[1-(OXOLAN-2-YL)ETHYL]-2,3-DIHYDRO-1H-ISOINDOLE-1,3-DIONE |
English Synonyms: | 5-AMINO-2-[1-(OXOLAN-2-YL)ETHYL]-2,3-DIHYDRO-1H-ISOINDOLE-1,3-DIONE |
MDL Number.: | MFCD12583652 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC(C1CCCO1)N2C(=O)c3ccc(cc3C2=O)N |
InChi: | InChI=1S/C14H16N2O3/c1-8(12-3-2-6-19-12)16-13(17)10-5-4-9(15)7-11(10)14(16)18/h4-5,7-8,12H,2-3,6,15H2,1H3 |
InChiKey: | InChIKey=PMXYASCQZFWQJK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.