* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-((BICYCLO[2.2.1]HEPT-5-EN-2-YLMETHYL)AMINO)-2,3-DIHYDRO-1H-1,3-BENZODIAZOL-2-ONE |
English Synonyms: | 5-((BICYCLO[2.2.1]HEPT-5-EN-2-YLMETHYL)AMINO)-2,3-DIHYDRO-1H-1,3-BENZODIAZOL-2-ONE |
MDL Number.: | MFCD12599901 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | c1cc2c(cc1NCC3CC4CC3C=C4)[nH]c(=O)[nH]2 |
InChi: | InChI=1S/C15H17N3O/c19-15-17-13-4-3-12(7-14(13)18-15)16-8-11-6-9-1-2-10(11)5-9/h1-4,7,9-11,16H,5-6,8H2,(H2,17,18,19) |
InChiKey: | InChIKey=CRJBMVKPJAVGCX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.