* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-BROMO-3-([2-(THIOPHEN-2-YL)ETHYL]AMINO)-2,3-DIHYDRO-1H-INDOL-2-ONE |
| English Synonyms: | 5-BROMO-3-([2-(THIOPHEN-2-YL)ETHYL]AMINO)-2,3-DIHYDRO-1H-INDOL-2-ONE |
| MDL Number.: | MFCD12624723 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | BrC=1C=C2C(C(NC2=CC1)=O)NCCC=1SC=CC1 |
| InChi: | InChI=1S/C14H13BrN2OS/c15-9-3-4-12-11(8-9)13(14(18)17-12)16-6-5-10-2-1-7-19-10/h1-4,7-8,13,16H,5-6H2,(H,17,18) |
| InChiKey: | InChIKey=HYJPYEUOVRHSII-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.