* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HEXYL[3-(1H-INDOL-1-YL)PROPYL]AMINE |
English Synonyms: | HEXYL[3-(1H-INDOL-1-YL)PROPYL]AMINE |
MDL Number.: | MFCD12634063 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCCCCNCCCn1ccc2c1cccc2 |
InChi: | InChI=1S/C17H26N2/c1-2-3-4-7-12-18-13-8-14-19-15-11-16-9-5-6-10-17(16)19/h5-6,9-11,15,18H,2-4,7-8,12-14H2,1H3 |
InChiKey: | InChIKey=IRTLMSWNBQOKHM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.