* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-NITRO-6-(PENTYLAMINO)-2,3-DIHYDRO-1H-INDOL-2-ONE |
| English Synonyms: | 5-NITRO-6-(PENTYLAMINO)-2,3-DIHYDRO-1H-INDOL-2-ONE |
| MDL Number.: | MFCD12635745 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCCCCNc1cc2c(cc1[N+](=O)[O-])CC(=O)N2 |
| InChi: | InChI=1S/C13H17N3O3/c1-2-3-4-5-14-11-8-10-9(7-13(17)15-10)6-12(11)16(18)19/h6,8,14H,2-5,7H2,1H3,(H,15,17) |
| InChiKey: | InChIKey=OGNKRDTWLNJWAN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.