* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 5-[3-(4-ETHYLPHENYL)-1,2,4-OXADIAZOL-5-YL]PENTAN-1-AMINE |
English Synonyms: | 5-[3-(4-ETHYLPHENYL)-1,2,4-OXADIAZOL-5-YL]PENTAN-1-AMINE |
MDL Number.: | MFCD12691651 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCc1ccc(cc1)c2nc(on2)CCCCCN |
InChi: | InChI=1S/C15H21N3O/c1-2-12-7-9-13(10-8-12)15-17-14(19-18-15)6-4-3-5-11-16/h7-10H,2-6,11,16H2,1H3 |
InChiKey: | InChIKey=SIBJWESSTNEIPP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.