* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-FLUORO-1-[3-(1H-IMIDAZOL-1-YL)PROPYL]-1H-1,3-BENZODIAZOLE-2-THIOL |
| English Synonyms: | 5-FLUORO-1-[3-(1H-IMIDAZOL-1-YL)PROPYL]-1H-1,3-BENZODIAZOLE-2-THIOL |
| MDL Number.: | MFCD12696024 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | c1cc2c(cc1F)nc(n2CCCn3ccnc3)S |
| InChi: | InChI=1S/C13H13FN4S/c14-10-2-3-12-11(8-10)16-13(19)18(12)6-1-5-17-7-4-15-9-17/h2-4,7-9H,1,5-6H2,(H,16,19) |
| InChiKey: | InChIKey=VQBRQSXKBHZDLV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.