* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-FLUORO-1-[3-(1H-IMIDAZOL-1-YL)PROPYL]-1H-1,3-BENZODIAZOL-2-AMINE |
English Synonyms: | 5-FLUORO-1-[3-(1H-IMIDAZOL-1-YL)PROPYL]-1H-1,3-BENZODIAZOL-2-AMINE |
MDL Number.: | MFCD12696219 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cc2c(cc1F)nc(n2CCCn3ccnc3)N |
InChi: | InChI=1S/C13H14FN5/c14-10-2-3-12-11(8-10)17-13(15)19(12)6-1-5-18-7-4-16-9-18/h2-4,7-9H,1,5-6H2,(H2,15,17) |
InChiKey: | InChIKey=GWRWDFMPDHRPFW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.