* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-BROMO-1-(2-METHOXYPHENYL)-1H-1,3-BENZODIAZOL-2-AMINE |
| English Synonyms: | 5-BROMO-1-(2-METHOXYPHENYL)-1H-1,3-BENZODIAZOL-2-AMINE |
| MDL Number.: | MFCD12696247 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | COc1ccccc1n2c3ccc(cc3nc2N)Br |
| InChi: | InChI=1S/C14H12BrN3O/c1-19-13-5-3-2-4-12(13)18-11-7-6-9(15)8-10(11)17-14(18)16/h2-8H,1H3,(H2,16,17) |
| InChiKey: | InChIKey=FXXJMKOWQYPNAE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.