* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-BROMO-1-(3,4-DIMETHYLPHENYL)-1H-1,3-BENZODIAZOL-2-AMINE |
| English Synonyms: | 5-BROMO-1-(3,4-DIMETHYLPHENYL)-1H-1,3-BENZODIAZOL-2-AMINE |
| MDL Number.: | MFCD12696273 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(cc1C)n2c3ccc(cc3nc2N)Br |
| InChi: | InChI=1S/C15H14BrN3/c1-9-3-5-12(7-10(9)2)19-14-6-4-11(16)8-13(14)18-15(19)17/h3-8H,1-2H3,(H2,17,18) |
| InChiKey: | InChIKey=SHBNDSPKZFFALA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.