* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 5-CHLORO-N-(4-METHYLPENTAN-2-YL)-2-(1H-1,2,4-TRIAZOL-1-YL)ANILINE |
English Synonyms: | 5-CHLORO-N-(4-METHYLPENTAN-2-YL)-2-(1H-1,2,4-TRIAZOL-1-YL)ANILINE |
MDL Number.: | MFCD12698871 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(C)CC(C)Nc1cc(ccc1n2cncn2)Cl |
InChi: | InChI=1S/C14H19ClN4/c1-10(2)6-11(3)18-13-7-12(15)4-5-14(13)19-9-16-8-17-19/h4-5,7-11,18H,6H2,1-3H3 |
InChiKey: | InChIKey=HYCZKZKSUPEMDF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.