* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-CHLORO-N-[2-(1H-1,2,3,4-TETRAZOL-1-YL)PHENYL]PENTANAMIDE |
English Synonyms: | 5-CHLORO-N-[2-(1H-1,2,3,4-TETRAZOL-1-YL)PHENYL]PENTANAMIDE |
MDL Number.: | MFCD12701871 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | c1ccc(c(c1)NC(=O)CCCCCl)n2cnnn2 |
InChi: | InChI=1S/C12H14ClN5O/c13-8-4-3-7-12(19)15-10-5-1-2-6-11(10)18-9-14-16-17-18/h1-2,5-6,9H,3-4,7-8H2,(H,15,19) |
InChiKey: | InChIKey=XQWJGGNAZUYCRL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.