* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-((1-AZABICYCLO[2.2.2]OCTAN-3-YL)AMINO)-2-FLUOROBENZAMIDE |
| English Synonyms: | 5-((1-AZABICYCLO[2.2.2]OCTAN-3-YL)AMINO)-2-FLUOROBENZAMIDE |
| MDL Number.: | MFCD12702890 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1cc(c(cc1NC2CN3CCC2CC3)C(=O)N)F |
| InChi: | InChI=1S/C14H18FN3O/c15-12-2-1-10(7-11(12)14(16)19)17-13-8-18-5-3-9(13)4-6-18/h1-2,7,9,13,17H,3-6,8H2,(H2,16,19) |
| InChiKey: | InChIKey=NLOLVKDVJNNATI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.