* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC254495 |
English Synonyms: | BCH-RESEARCH BC254495 |
MDL Number.: | MFCD12709284 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | c1cc(cc(c1)NS(=O)(=O)N)NCc2ccc(s2)Cl |
InChi: | InChI=1S/C11H12ClN3O2S2/c12-11-5-4-10(18-11)7-14-8-2-1-3-9(6-8)15-19(13,16)17/h1-6,14-15H,7H2,(H2,13,16,17) |
InChiKey: | InChIKey=FHJJVAYXOILYQV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.