* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC313896 |
English Synonyms: | BCH-RESEARCH BC313896 |
MDL Number.: | MFCD12719680 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1c(cc(c(c1Cl)S(=O)(=O)NCCS(=O)(=O)N)Cl)Br |
InChi: | InChI=1S/C8H9BrCl2N2O4S2/c9-5-3-6(10)8(7(11)4-5)19(16,17)13-1-2-18(12,14)15/h3-4,13H,1-2H2,(H2,12,14,15) |
InChiKey: | InChIKey=DORDTMQTSZQBJU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.