* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-CHLORO-2-(PIPERIDIN-3-YL)-1-(PROPAN-2-YL)-1H-1,3-BENZODIAZOLE |
English Synonyms: | 5-CHLORO-2-(PIPERIDIN-3-YL)-1-(PROPAN-2-YL)-1H-1,3-BENZODIAZOLE |
MDL Number.: | MFCD12720880 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(C)n1c2ccc(cc2nc1C3CCCNC3)Cl |
InChi: | InChI=1S/C15H20ClN3/c1-10(2)19-14-6-5-12(16)8-13(14)18-15(19)11-4-3-7-17-9-11/h5-6,8,10-11,17H,3-4,7,9H2,1-2H3 |
InChiKey: | InChIKey=PZLDNIFENFWKCA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.