* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 5-CHLORO-1-(PROPAN-2-YL)-2-(PYRROLIDIN-2-YL)-1H-1,3-BENZODIAZOLE |
English Synonyms: | 5-CHLORO-1-(PROPAN-2-YL)-2-(PYRROLIDIN-2-YL)-1H-1,3-BENZODIAZOLE |
MDL Number.: | MFCD12720892 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(C)n1c2ccc(cc2nc1C3CCCN3)Cl |
InChi: | InChI=1S/C14H18ClN3/c1-9(2)18-13-6-5-10(15)8-12(13)17-14(18)11-4-3-7-16-11/h5-6,8-9,11,16H,3-4,7H2,1-2H3 |
InChiKey: | InChIKey=UIEDQJRMLQLTHJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.