* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 5-(6-BROMO-1H-1,3-BENZODIAZOL-2-YL)-2-CHLOROANILINE |
English Synonyms: | 5-(6-BROMO-1H-1,3-BENZODIAZOL-2-YL)-2-CHLOROANILINE |
MDL Number.: | MFCD12720929 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1cc(c(cc1c2[nH]c3cc(ccc3n2)Br)N)Cl |
InChi: | InChI=1S/C13H9BrClN3/c14-8-2-4-11-12(6-8)18-13(17-11)7-1-3-9(15)10(16)5-7/h1-6H,16H2,(H,17,18) |
InChiKey: | InChIKey=QJGXAKBXSJVXDR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.