* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-(5-BROMO-1-METHYL-1H-1,3-BENZODIAZOL-2-YL)PENTAN-1-AMINE |
English Synonyms: | 5-(5-BROMO-1-METHYL-1H-1,3-BENZODIAZOL-2-YL)PENTAN-1-AMINE |
MDL Number.: | MFCD12720945 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cn1c2ccc(cc2nc1CCCCCN)Br |
InChi: | InChI=1S/C13H18BrN3/c1-17-12-7-6-10(14)9-11(12)16-13(17)5-3-2-4-8-15/h6-7,9H,2-5,8,15H2,1H3 |
InChiKey: | InChIKey=YRJCTDOPZRJBPF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.