* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC273735 |
| English Synonyms: | BCH-RESEARCH BC273735 |
| MDL Number.: | MFCD12726954 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CCn1cc(c(n1)N)S(=O)(=O)NCC(=O)OC |
| InChi: | InChI=1S/C8H14N4O4S/c1-3-12-5-6(8(9)11-12)17(14,15)10-4-7(13)16-2/h5,10H,3-4H2,1-2H3,(H2,9,11) |
| InChiKey: | InChIKey=HSLXHPJVZFSKGW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.