* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC273924 |
| English Synonyms: | BCH-RESEARCH BC273924 |
| MDL Number.: | MFCD12727130 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CCn1cc(c(n1)N)S(=O)(=O)N(C)CCC#N |
| InChi: | InChI=1S/C9H15N5O2S/c1-3-14-7-8(9(11)12-14)17(15,16)13(2)6-4-5-10/h7H,3-4,6H2,1-2H3,(H2,11,12) |
| InChiKey: | InChIKey=YZYPNFJXUQEBOX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.