* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC274014 |
| English Synonyms: | BCH-RESEARCH BC274014 |
| MDL Number.: | MFCD12727204 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | CCCn1cc(c(n1)N)S(=O)(=O)NCC(=O)NC |
| InChi: | InChI=1S/C9H17N5O3S/c1-3-4-14-6-7(9(10)13-14)18(16,17)12-5-8(15)11-2/h6,12H,3-5H2,1-2H3,(H2,10,13)(H,11,15) |
| InChiKey: | InChIKey=ZSLCGKCXNMQYJU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.