* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC422621 |
English Synonyms: | BCH-RESEARCH BC422621 |
MDL Number.: | MFCD12727216 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | CCCn1cc(c(n1)N)S(=O)(=O)N(C)CC(=O)N |
InChi: | InChI=1S/C9H17N5O3S/c1-3-4-14-5-7(9(11)12-14)18(16,17)13(2)6-8(10)15/h5H,3-4,6H2,1-2H3,(H2,10,15)(H2,11,12) |
InChiKey: | InChIKey=NDJOMTOXEBVGOD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.