* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC274026 |
| English Synonyms: | BCH-RESEARCH BC274026 |
| MDL Number.: | MFCD12727217 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CCn1cc(c(n1)N)S(=O)(=O)N(C)CC(=O)NC |
| InChi: | InChI=1S/C9H17N5O3S/c1-4-14-5-7(9(10)12-14)18(16,17)13(3)6-8(15)11-2/h5H,4,6H2,1-3H3,(H2,10,12)(H,11,15) |
| InChiKey: | InChIKey=SKTSYWOAESUWPC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.