* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC274034 |
| English Synonyms: | BCH-RESEARCH BC274034 |
| MDL Number.: | MFCD12727224 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CC(C)C(C(=O)OC)NS(=O)(=O)c1cn(nc1N)C |
| InChi: | InChI=1S/C10H18N4O4S/c1-6(2)8(10(15)18-4)13-19(16,17)7-5-14(3)12-9(7)11/h5-6,8,13H,1-4H3,(H2,11,12) |
| InChiKey: | InChIKey=YXLVZVFGZXJMKA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.